C30H48O4Si2 — CID 15120841
[(E)-3,6-bis[(3-methoxyphenyl)methyl]-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane (PubChem CID 15120841) has the molecular formula C30H48O4Si2 and a molecular weight of 528.88 g/mol. Its IUPAC name is [(E)-3,6-bis[(3-methoxyphenyl)methyl]-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-3,6-bis[(3-methoxyphenyl)methyl]-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15120841 |
| Molecular Formula | C30H48O4Si2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(E)-3,6-bis[(3-methoxyphenyl)methyl]-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane |
| SMILES | CCC(Cc1cccc(OC)c1)/C(O[Si](C)(C)C)=C(\O[Si](C)(C)C)C(CC)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C30H48O4Si2/c1-11-25(19-23-15-13-17-27(21-23)31-3)29(33-35(5,6)7)30(34-36(8,9)10)26(12-2)20-24-16-14-18-28(22-24)32-4/h13-18,21-22,25-26H,11-12,19-20H2,1-10H3/b30-29+ |
| InChIKey | MENBBKQTFPKBPW-QVIHXGFCSA-N |
| XLogP | 8.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|