C28H44O4Si2 — CID 68525614
[1,8-bis(3-methoxyphenyl)-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane (PubChem CID 68525614) has the molecular formula C28H44O4Si2 and a molecular weight of 500.83 g/mol. Its IUPAC name is [1,8-bis(3-methoxyphenyl)-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane.
| Compound Name | [1,8-bis(3-methoxyphenyl)-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 68525614 |
| Molecular Formula | C28H44O4Si2 |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [1,8-bis(3-methoxyphenyl)-5-trimethylsilyloxyoct-4-en-4-yl]oxy-trimethylsilane |
| SMILES | COc1cccc(CCCC(O[Si](C)(C)C)=C(CCCc2cccc(OC)c2)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C28H44O4Si2/c1-29-25-17-9-13-23(21-25)15-11-19-27(31-33(3,4)5)28(32-34(6,7)8)20-12-16-24-14-10-18-26(22-24)30-2/h9-10,13-14,17-18,21-22H,11-12,15-16,19-20H2,1-8H3 |
| InChIKey | YLIZSTFSTQXEPG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|