C8H12N2O4S — CID 151215685
ethyl 1-(methylsulfonylmethyl)imidazole-2-carboxylate (PubChem CID 151215685) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is ethyl 1-(methylsulfonylmethyl)imidazole-2-carboxylate.
| Compound Name | ethyl 1-(methylsulfonylmethyl)imidazole-2-carboxylate |
|---|---|
| PubChem CID | 151215685 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | ethyl 1-(methylsulfonylmethyl)imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nccn1CS(C)(=O)=O |
| InChI | InChI=1S/C8H12N2O4S/c1-3-14-8(11)7-9-4-5-10(7)6-15(2,12)13/h4-5H,3,6H2,1-2H3 |
| InChIKey | NLFBLMCTEQPPBH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |