C14H15F3N4O2 — CID 56871621
ethyl 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]imidazole-2-carboxylate (PubChem CID 56871621) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is ethyl 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]imidazole-2-carboxylate.
| Compound Name | ethyl 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]imidazole-2-carboxylate |
|---|---|
| PubChem CID | 56871621 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nccn1CCc1nc(C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H15F3N4O2/c1-3-23-13(22)12-18-5-7-21(12)6-4-11-19-9(2)8-10(20-11)14(15,16)17/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | POWBOTPJPUTTCE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |