C15H17F3N4O — CID 56867673
4-methyl-2-[2-[2-(oxolan-3-yl)imidazol-1-yl]ethyl]-6-(trifluoromethyl)pyrimidine (PubChem CID 56867673) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-(oxolan-3-yl)imidazol-1-yl]ethyl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-methyl-2-[2-[2-(oxolan-3-yl)imidazol-1-yl]ethyl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 56867673 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-methyl-2-[2-[2-(oxolan-3-yl)imidazol-1-yl]ethyl]-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)nc(CCn2ccnc2C2CCOC2)n1 |
| InChI | InChI=1S/C15H17F3N4O/c1-10-8-12(15(16,17)18)21-13(20-10)2-5-22-6-4-19-14(22)11-3-7-23-9-11/h4,6,8,11H,2-3,5,7,9H2,1H3 |
| InChIKey | GZGTZWLXWBHXTN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |