C22H18F6O5 — CID 15122007
1-[4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran-5-yl]-2,2,2-trifluoroethanone (PubChem CID 15122007) has the molecular formula C22H18F6O5 and a molecular weight of 476.37 g/mol. Its IUPAC name is 1-[4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 15122007 |
| Molecular Formula | C22H18F6O5 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-[4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran-5-yl]-2,2,2-trifluoroethanone |
| SMILES | CCOC1CC(Oc2ccccc2)(Oc2ccccc2)OC(C(F)(F)F)=C1C(=O)C(F)(F)F |
| InChI | InChI=1S/C22H18F6O5/c1-2-30-16-13-20(31-14-9-5-3-6-10-14,32-15-11-7-4-8-12-15)33-19(22(26,27)28)17(16)18(29)21(23,24)25/h3-12,16H,2,13H2,1H3 |
| InChIKey | TZXKINUIZGAKRN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|