C41H36N2 — CID 151225285
1-N,1-N,6-N,6-N-tetrakis(3-methylphenyl)-9H-fluorene-1,6-diamine (PubChem CID 151225285) has the molecular formula C41H36N2 and a molecular weight of 556.75 g/mol. Its IUPAC name is 1-N,1-N,6-N,6-N-tetrakis(3-methylphenyl)-9H-fluorene-1,6-diamine.
| Compound Name | 1-N,1-N,6-N,6-N-tetrakis(3-methylphenyl)-9H-fluorene-1,6-diamine |
|---|---|
| PubChem CID | 151225285 |
| Molecular Formula | C41H36N2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 1-N,1-N,6-N,6-N-tetrakis(3-methylphenyl)-9H-fluorene-1,6-diamine |
| SMILES | Cc1cccc(N(c2cccc(C)c2)c2ccc3c(c2)-c2cccc(N(c4cccc(C)c4)c4cccc(C)c4)c2C3)c1 |
| InChI | InChI=1S/C41H36N2/c1-28-10-5-14-33(22-28)42(34-15-6-11-29(2)23-34)37-21-20-32-26-40-38(39(32)27-37)18-9-19-41(40)43(35-16-7-12-30(3)24-35)36-17-8-13-31(4)25-36/h5-25,27H,26H2,1-4H3 |
| InChIKey | NNDDMRPENMHEBQ-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |