C25H20F3N5O5S — CID 151229251
N'-[4-[2-methyl-5,7-dioxo-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]-3-pyridinyl]benzohydrazide (PubChem CID 151229251) has the molecular formula C25H20F3N5O5S and a molecular weight of 559.53 g/mol. Its IUPAC name is N'-[4-[2-methyl-5,7-dioxo-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]-3-pyridinyl]benzohydrazide.
| Compound Name | N'-[4-[2-methyl-5,7-dioxo-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]-3-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 151229251 |
| Molecular Formula | C25H20F3N5O5S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N'-[4-[2-methyl-5,7-dioxo-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]-3-pyridinyl]benzohydrazide |
| SMILES | CC1CC12C(=O)N(c1ccc(S(=O)(=O)C(F)(F)F)cc1)C(=O)N2c1ccncc1NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20F3N5O5S/c1-15-13-24(15)22(35)32(17-7-9-18(10-8-17)39(37,38)25(26,27)28)23(36)33(24)20-11-12-29-14-19(20)30-31-21(34)16-5-3-2-4-6-16/h2-12,14-15,30H,13H2,1H3,(H,31,34) |
| InChIKey | NNXUHQYZOVUFGC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|