C25H20F3N3O4S — CID 151720188
4-(3-benzyl-4-pyridinyl)-2-methyl-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 151720188) has the molecular formula C25H20F3N3O4S and a molecular weight of 515.51 g/mol. Its IUPAC name is 4-(3-benzyl-4-pyridinyl)-2-methyl-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 4-(3-benzyl-4-pyridinyl)-2-methyl-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 151720188 |
| Molecular Formula | C25H20F3N3O4S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 4-(3-benzyl-4-pyridinyl)-2-methyl-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | CC1CC12C(=O)N(c1ccc(S(=O)(=O)C(F)(F)F)cc1)C(=O)N2c1ccncc1Cc1ccccc1 |
| InChI | InChI=1S/C25H20F3N3O4S/c1-16-14-24(16)22(32)30(19-7-9-20(10-8-19)36(34,35)25(26,27)28)23(33)31(24)21-11-12-29-15-18(21)13-17-5-3-2-4-6-17/h2-12,15-16H,13-14H2,1H3 |
| InChIKey | RIKJKFIYDZPRDK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|