C31H37IN2O5 — CID 15123181
[5-(3,3-diphenylpropoxy)oxolan-3-yl]methyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide (PubChem CID 15123181) has the molecular formula C31H37IN2O5 and a molecular weight of 644.55 g/mol. Its IUPAC name is [5-(3,3-diphenylpropoxy)oxolan-3-yl]methyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide.
| Compound Name | [5-(3,3-diphenylpropoxy)oxolan-3-yl]methyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide |
|---|---|
| PubChem CID | 15123181 |
| Molecular Formula | C31H37IN2O5 |
| Molecular Weight | 644.55 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [5-(3,3-diphenylpropoxy)oxolan-3-yl]methyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide |
| SMILES | CC[n+]1ccccc1CN(C(C)=O)C(=O)OCC1COC(OCCC(c2ccccc2)c2ccccc2)C1.[I-] |
| InChI | InChI=1S/C31H37N2O5.HI/c1-3-32-18-11-10-16-28(32)21-33(24(2)34)31(35)38-23-25-20-30(37-22-25)36-19-17-29(26-12-6-4-7-13-26)27-14-8-5-9-15-27;/h4-16,18,25,29-30H,3,17,19-23H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OJVYMIPIMXXEOA-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|