About 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate
2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 15724562) has the molecular formula C20H31N2O6+
and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
| PubChem CID | 15724562 |
| Molecular Formula | C20H31N2O6+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC[n+]1ccccc1CN(C(C)=O)C(=O)OCCOCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H31N2O6/c1-6-21-10-8-7-9-17(21)15-22(16(2)23)19(25)28-14-12-26-11-13-27-18(24)20(3,4)5/h7-10H,6,11-15H2,1-5H3/q+1 |
| InChIKey | GNRJWIVTHUQWKU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate (CID 15724562) is 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate is CC[n+]1ccccc1CN(C(C)=O)C(=O)OCCOCCOC(=O)C(C)(C)C.
What is the InChIKey of 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate?
The InChIKey is GNRJWIVTHUQWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N2O6/c1-6-21-10-8-7-9-17(21)15-22(16(2)23)19(25)28-14-12-26-11-13-27-18(24)20(3,4)5/h7-10H,6,11-15H2,1-5H3/q+1.
What are the key properties of 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate?
2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate has a molecular weight of 395.48 g/mol, XLogP of 2.09, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 15724562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).