C20H31N2O6+ — CID 15724562
2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 15724562) has the molecular formula C20H31N2O6+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15724562 |
| Molecular Formula | C20H31N2O6+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[2-[acetyl-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC[n+]1ccccc1CN(C(C)=O)C(=O)OCCOCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H31N2O6/c1-6-21-10-8-7-9-17(21)15-22(16(2)23)19(25)28-14-12-26-11-13-27-18(24)20(3,4)5/h7-10H,6,11-15H2,1-5H3/q+1 |
| InChIKey | GNRJWIVTHUQWKU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|