C18H26N2O6 — CID 19886461
2-[2-[acetyl(pyridin-2-ylmethyl)carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 19886461) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[2-[acetyl(pyridin-2-ylmethyl)carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[acetyl(pyridin-2-ylmethyl)carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 19886461 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[2-[acetyl(pyridin-2-ylmethyl)carbamoyl]oxyethoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)N(Cc1ccccn1)C(=O)OCCOCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H26N2O6/c1-14(21)20(13-15-7-5-6-8-19-15)17(23)26-12-10-24-9-11-25-16(22)18(2,3)4/h5-8H,9-13H2,1-4H3 |
| InChIKey | SKLWCBHFAHRKHV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|