About 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one
2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 15123481) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 15123481 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=CC(O)=C(C(C)=O)C1=O |
| InChI | InChI=1S/C10H12O5/c1-6(11)8-7(12)4-5-10(14-2,15-3)9(8)13/h4-5,12H,1-3H3 |
| InChIKey | QCPUSUUSQLRBEA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one (CID 15123481) is 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one is COC1(OC)C=CC(O)=C(C(C)=O)C1=O.
What is the InChIKey of 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The InChIKey is QCPUSUUSQLRBEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-6(11)8-7(12)4-5-10(14-2,15-3)9(8)13/h4-5,12H,1-3H3.
What are the key properties of 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one has a molecular weight of 212.20 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 15123481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).