C11H14O6 — CID 15123487
2-acetyl-3-hydroxy-5,6,6-trimethoxycyclohexa-2,4-dien-1-one (PubChem CID 15123487) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-5,6,6-trimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 2-acetyl-3-hydroxy-5,6,6-trimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15123487 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-acetyl-3-hydroxy-5,6,6-trimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(O)=C(C(C)=O)C(=O)C1(OC)OC |
| InChI | InChI=1S/C11H14O6/c1-6(12)9-7(13)5-8(15-2)11(16-3,17-4)10(9)14/h5,13H,1-4H3 |
| InChIKey | QSXLILWTWRWUFI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|