C22H32O6 — CID 15694258
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxy-4-[(E)-3-hydroxybut-2-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 15694258) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxy-4-[(E)-3-hydroxybut-2-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxy-4-[(E)-3-hydroxybut-2-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15694258 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxy-4-[(E)-3-hydroxybut-2-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C(=O)C(C/C=C(\C)CCC=C(C)C)=C(O)C(C/C=C(\C)O)=C1O |
| InChI | InChI=1S/C22H32O6/c1-14(2)8-7-9-15(3)10-12-17-19(24)18(13-11-16(4)23)21(26)22(27-5,28-6)20(17)25/h8,10-11,23-24,26H,7,9,12-13H2,1-6H3/b15-10+,16-11+ |
| InChIKey | HYTKUARFMAPPJL-RWPWKDLBSA-N |
| XLogP | 5.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|