C23H34O5 — CID 74985840
4-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6,6-dimethoxy-2-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one (PubChem CID 74985840) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6,6-dimethoxy-2-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6,6-dimethoxy-2-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 74985840 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6,6-dimethoxy-2-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C(=O)C(CC=C(C)C)=C(O)C(CC=C(C)CCC=C(C)C)=C1O |
| InChI | InChI=1S/C23H34O5/c1-15(2)9-8-10-17(5)12-14-19-20(24)18(13-11-16(3)4)21(25)23(27-6,28-7)22(19)26/h9,11-12,24,26H,8,10,13-14H2,1-7H3 |
| InChIKey | QMTCAGOTJULFRB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|