C12H16O7 — CID 15123490
2-acetyl-3-hydroxy-4,5,6,6-tetramethoxycyclohexa-2,4-dien-1-one (PubChem CID 15123490) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-4,5,6,6-tetramethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 2-acetyl-3-hydroxy-4,5,6,6-tetramethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15123490 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-acetyl-3-hydroxy-4,5,6,6-tetramethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=C(OC)C(OC)(OC)C(=O)C(C(C)=O)=C1O |
| InChI | InChI=1S/C12H16O7/c1-6(13)7-8(14)9(16-2)11(17-3)12(18-4,19-5)10(7)15/h14H,1-5H3 |
| InChIKey | LRNWAAJXQKFYKR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|