C16H14F3N3O4S — CID 151248574
3-ethyl-2-[1-methyl-5-(trifluoromethoxy)benzimidazol-2-yl]pyridine-4-sulfonic acid (PubChem CID 151248574) has the molecular formula C16H14F3N3O4S and a molecular weight of 401.37 g/mol. Its IUPAC name is 3-ethyl-2-[1-methyl-5-(trifluoromethoxy)benzimidazol-2-yl]pyridine-4-sulfonic acid.
| Compound Name | 3-ethyl-2-[1-methyl-5-(trifluoromethoxy)benzimidazol-2-yl]pyridine-4-sulfonic acid |
|---|---|
| PubChem CID | 151248574 |
| Molecular Formula | C16H14F3N3O4S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-ethyl-2-[1-methyl-5-(trifluoromethoxy)benzimidazol-2-yl]pyridine-4-sulfonic acid |
| SMILES | CCc1c(S(=O)(=O)O)ccnc1-c1nc2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C16H14F3N3O4S/c1-3-10-13(27(23,24)25)6-7-20-14(10)15-21-11-8-9(26-16(17,18)19)4-5-12(11)22(15)2/h4-8H,3H2,1-2H3,(H,23,24,25) |
| InChIKey | NRVJEKFMCOWAHS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|