C9H8F3N3O — CID 69449777
1-methyl-5-(trifluoromethoxy)benzimidazol-2-amine (PubChem CID 69449777) has the molecular formula C9H8F3N3O and a molecular weight of 231.18 g/mol. Its IUPAC name is 1-methyl-5-(trifluoromethoxy)benzimidazol-2-amine.
| Compound Name | 1-methyl-5-(trifluoromethoxy)benzimidazol-2-amine |
|---|---|
| PubChem CID | 69449777 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-methyl-5-(trifluoromethoxy)benzimidazol-2-amine |
| SMILES | Cn1c(N)nc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C9H8F3N3O/c1-15-7-3-2-5(16-9(10,11)12)4-6(7)14-8(15)13/h2-4H,1H3,(H2,13,14) |
| InChIKey | QSEARZBVRHBESL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |