About 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid
7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid (PubChem CID 15125128) has the molecular formula C22H26ClFO3
and a molecular weight of 392.90 g/mol. Its IUPAC name is 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid.
Molecular Properties
| Compound Name | 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid |
| PubChem CID | 15125128 |
| Molecular Formula | C22H26ClFO3 |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid |
| SMILES | Cc1c(C)c(Cl)c(C)c(C(CCCCCC(=O)O)c2ccc(F)cc2)c1O |
| InChI | InChI=1S/C22H26ClFO3/c1-13-14(2)22(27)20(15(3)21(13)23)18(7-5-4-6-8-19(25)26)16-9-11-17(24)12-10-16/h9-12,18,27H,4-8H2,1-3H3,(H,25,26) |
| InChIKey | KRCOYINJFOJHLY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid?
The IUPAC name of 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid (CID 15125128) is 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid.
What is the SMILES notation for 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid?
The canonical SMILES for 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid is Cc1c(C)c(Cl)c(C)c(C(CCCCCC(=O)O)c2ccc(F)cc2)c1O.
What is the InChIKey of 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid?
The InChIKey is KRCOYINJFOJHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26ClFO3/c1-13-14(2)22(27)20(15(3)21(13)23)18(7-5-4-6-8-19(25)26)16-9-11-17(24)12-10-16/h9-12,18,27H,4-8H2,1-3H3,(H,25,26).
What are the key properties of 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid?
7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid has a molecular weight of 392.90 g/mol, XLogP of 6.28, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid is sourced from PubChem (CID 15125128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).