C22H26ClFO3 — CID 15125128
7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid (PubChem CID 15125128) has the molecular formula C22H26ClFO3 and a molecular weight of 392.90 g/mol. Its IUPAC name is 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid.
| Compound Name | 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid |
|---|---|
| PubChem CID | 15125128 |
| Molecular Formula | C22H26ClFO3 |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-(5-chloro-2-hydroxy-3,4,6-trimethylphenyl)-7-(4-fluorophenyl)heptanoic acid |
| SMILES | Cc1c(C)c(Cl)c(C)c(C(CCCCCC(=O)O)c2ccc(F)cc2)c1O |
| InChI | InChI=1S/C22H26ClFO3/c1-13-14(2)22(27)20(15(3)21(13)23)18(7-5-4-6-8-19(25)26)16-9-11-17(24)12-10-16/h9-12,18,27H,4-8H2,1-3H3,(H,25,26) |
| InChIKey | KRCOYINJFOJHLY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|