C18H14ClFN2O — CID 151252973
3-(3-chloro-4-fluorophenyl)-2-methoxy-5-(pyridin-3-ylmethyl)pyridine (PubChem CID 151252973) has the molecular formula C18H14ClFN2O and a molecular weight of 328.77 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-2-methoxy-5-(pyridin-3-ylmethyl)pyridine.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-2-methoxy-5-(pyridin-3-ylmethyl)pyridine |
|---|---|
| PubChem CID | 151252973 |
| Molecular Formula | C18H14ClFN2O |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-2-methoxy-5-(pyridin-3-ylmethyl)pyridine |
| SMILES | COc1ncc(Cc2cccnc2)cc1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN2O/c1-23-18-15(14-4-5-17(20)16(19)9-14)8-13(11-22-18)7-12-3-2-6-21-10-12/h2-6,8-11H,7H2,1H3 |
| InChIKey | NSSMNXPKJXVJRX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |