C27H33N3O7 — CID 151266430
5-amino-4-[7-[(4-methylphenyl)-(2-morpholin-4-ylethoxy)methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid (PubChem CID 151266430) has the molecular formula C27H33N3O7 and a molecular weight of 511.58 g/mol. Its IUPAC name is 5-amino-4-[7-[(4-methylphenyl)-(2-morpholin-4-ylethoxy)methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[7-[(4-methylphenyl)-(2-morpholin-4-ylethoxy)methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 151266430 |
| Molecular Formula | C27H33N3O7 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 5-amino-4-[7-[(4-methylphenyl)-(2-morpholin-4-ylethoxy)methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid |
| SMILES | Cc1ccc(C(OCCN2CCOCC2)Oc2cccc3c2CN(C(CCC(=O)O)C(N)=O)C3=O)cc1 |
| InChI | InChI=1S/C27H33N3O7/c1-18-5-7-19(8-6-18)27(36-16-13-29-11-14-35-15-12-29)37-23-4-2-3-20-21(23)17-30(26(20)34)22(25(28)33)9-10-24(31)32/h2-8,22,27H,9-17H2,1H3,(H2,28,33)(H,31,32) |
| InChIKey | NVLDOSQYVGALEA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|