C29H26F3N3O3S2 — CID 151271555
N-[2-sulfanyl-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 151271555) has the molecular formula C29H26F3N3O3S2 and a molecular weight of 585.67 g/mol. Its IUPAC name is N-[2-sulfanyl-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[2-sulfanyl-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 151271555 |
| Molecular Formula | C29H26F3N3O3S2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | N-[2-sulfanyl-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)c(S)c1)N1CCC(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C29H26F3N3O3S2/c30-29(31,32)23-9-6-19(7-10-23)17-20-12-15-35(16-13-20)28(36)22-8-11-24(25(39)18-22)34-40(37,38)26-5-1-3-21-4-2-14-33-27(21)26/h1-11,14,18,20,34,39H,12-13,15-17H2 |
| InChIKey | NWMCMHAECLLDRQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|