C28H27FN6O — CID 151274262
N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-5-(furan-3-yl)-4-(1-methylindol-3-yl)pyrimidin-2-amine (PubChem CID 151274262) has the molecular formula C28H27FN6O and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-5-(furan-3-yl)-4-(1-methylindol-3-yl)pyrimidin-2-amine.
| Compound Name | N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-5-(furan-3-yl)-4-(1-methylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 151274262 |
| Molecular Formula | C28H27FN6O |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-5-(furan-3-yl)-4-(1-methylindol-3-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4ccoc4)c(-c4cn(C)c5ccccc45)n3)cc2F)CC1 |
| InChI | InChI=1S/C28H27FN6O/c1-33-10-12-35(13-11-33)26-8-7-20(15-24(26)29)31-28-30-16-22(19-9-14-36-18-19)27(32-28)23-17-34(2)25-6-4-3-5-21(23)25/h3-9,14-18H,10-13H2,1-2H3,(H,30,31,32) |
| InChIKey | NXALIRXQRUKFBP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|