C33H40FN7O3 — CID 151287668
(2S)-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 151287668) has the molecular formula C33H40FN7O3 and a molecular weight of 601.73 g/mol. Its IUPAC name is (2S)-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 151287668 |
| Molecular Formula | C33H40FN7O3 |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | (2S)-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | Cc1nc(N[C@@H](CCN(CCCCc2ccc3c(n2)NCCC3)CCOc2cccnc2C)C(=O)O)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C33H40FN7O3/c1-22-30(9-6-15-35-22)44-20-19-41(17-4-3-8-26-12-10-24-7-5-16-36-31(24)39-26)18-14-28(33(42)43)40-32-27-13-11-25(34)21-29(27)37-23(2)38-32/h6,9-13,15,21,28H,3-5,7-8,14,16-20H2,1-2H3,(H,36,39)(H,42,43)(H,37,38,40)/t28-/m0/s1 |
| InChIKey | NZTCSZHVEDAYAX-NDEPHWFRSA-N |
| XLogP | 5.19 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|