C24H28FN5O2 — CID 130446901
6-(6-fluoro-5-methoxy-3-pyridinyl)-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine (PubChem CID 130446901) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is 6-(6-fluoro-5-methoxy-3-pyridinyl)-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine.
| Compound Name | 6-(6-fluoro-5-methoxy-3-pyridinyl)-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 130446901 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 6-(6-fluoro-5-methoxy-3-pyridinyl)-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
| SMILES | COc1cc(-c2ccc3ncnc(NC4CCC(N5CCOCC5)CC4)c3c2)cnc1F |
| InChI | InChI=1S/C24H28FN5O2/c1-31-22-13-17(14-26-23(22)25)16-2-7-21-20(12-16)24(28-15-27-21)29-18-3-5-19(6-4-18)30-8-10-32-11-9-30/h2,7,12-15,18-19H,3-6,8-11H2,1H3,(H,27,28,29) |
| InChIKey | MHAOVOXJJQOYDK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|