C27H27N5O2 — CID 44521024
4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine (PubChem CID 44521024) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine.
| Compound Name | 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 44521024 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| SMILES | Cc1cc(Oc2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)c(-c2ccccn2)nc1C |
| InChI | InChI=1S/C27H27N5O2/c1-19-17-25(27(30-20(19)2)24-5-3-4-11-28-24)34-23-10-12-29-26(18-23)31-21-6-8-22(9-7-21)32-13-15-33-16-14-32/h3-12,17-18H,13-16H2,1-2H3,(H,29,31) |
| InChIKey | IMQLUYVCVAGOQD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|