C17H24F3N3O2 — CID 151294404
tert-butyl N-[[(3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]carbamate (PubChem CID 151294404) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is tert-butyl N-[[(3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 151294404 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl N-[[(3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@@H]1CN(CC(F)(F)F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-16(2,3)25-15(24)22-21-14-10-23(11-17(18,19)20)9-13(14)12-7-5-4-6-8-12/h4-8,13-14,21H,9-11H2,1-3H3,(H,22,24)/t13-,14+/m0/s1 |
| InChIKey | OBCDFKVPODISGM-UONOGXRCSA-N |
| XLogP | 3.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|