About dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane
dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane (PubChem CID 151301893) has the molecular formula C24H51PSe
and a molecular weight of 449.61 g/mol. Its IUPAC name is dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane |
| PubChem CID | 151301893 |
| Molecular Formula | C24H51PSe |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane |
| SMILES | CCCCC(CCCC)(CCCC)CCCP(=[Se])(CCCC)CCCC |
| InChI | InChI=1S/C24H51PSe/c1-6-11-17-24(18-12-7-2,19-13-8-3)20-16-23-25(26,21-14-9-4)22-15-10-5/h6-23H2,1-5H3 |
| InChIKey | OCPGFOVEYNKVNV-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane?
The IUPAC name of dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane (CID 151301893) is dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane.
What is the SMILES notation for dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane?
The canonical SMILES for dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane is CCCCC(CCCC)(CCCC)CCCP(=[Se])(CCCC)CCCC.
What is the InChIKey of dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane?
The InChIKey is OCPGFOVEYNKVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51PSe/c1-6-11-17-24(18-12-7-2,19-13-8-3)20-16-23-25(26,21-14-9-4)22-15-10-5/h6-23H2,1-5H3.
What are the key properties of dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane?
dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane has a molecular weight of 449.61 g/mol, XLogP of 9.02, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-(4,4-dibutyloctyl)-selanylidene-λ5-phosphane is sourced from PubChem (CID 151301893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).