C15H28O4Si — CID 151302874
2-[(1S,3S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]acetic acid (PubChem CID 151302874) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 2-[(1S,3S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]acetic acid.
| Compound Name | 2-[(1S,3S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]acetic acid |
|---|---|
| PubChem CID | 151302874 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[(1S,3S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CC(=O)O)C[C@@H]2O[C@@]21C |
| InChI | InChI=1S/C15H28O4Si/c1-14(2,3)20(5,6)19-12-8-10(9-13(16)17)7-11-15(12,4)18-11/h10-12H,7-9H2,1-6H3,(H,16,17)/t10-,11-,12+,15-/m0/s1 |
| InChIKey | OCUCQHOYWCVSPS-OHTBPHCPSA-N |
| XLogP | 3.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|