C15H26O4Si — CID 10924515
(1aR,2aS,5aS,6S,6aS)-1a-methyl-6-triethylsilyloxy-2,2a,5,5a,6,6a-hexahydrooxireno[2,3-f][1]benzofuran-4-one (PubChem CID 10924515) has the molecular formula C15H26O4Si and a molecular weight of 298.45 g/mol. Its IUPAC name is (1aR,2aS,5aS,6S,6aS)-1a-methyl-6-triethylsilyloxy-2,2a,5,5a,6,6a-hexahydrooxireno[2,3-f][1]benzofuran-4-one.
| Compound Name | (1aR,2aS,5aS,6S,6aS)-1a-methyl-6-triethylsilyloxy-2,2a,5,5a,6,6a-hexahydrooxireno[2,3-f][1]benzofuran-4-one |
|---|---|
| PubChem CID | 10924515 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1aR,2aS,5aS,6S,6aS)-1a-methyl-6-triethylsilyloxy-2,2a,5,5a,6,6a-hexahydrooxireno[2,3-f][1]benzofuran-4-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H]2CC(=O)O[C@H]2C[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C15H26O4Si/c1-5-20(6-2,7-3)19-13-10-8-12(16)17-11(10)9-15(4)14(13)18-15/h10-11,13-14H,5-9H2,1-4H3/t10-,11-,13-,14-,15+/m0/s1 |
| InChIKey | LIAXDQMZUJXPHW-IXDBCEGASA-N |
| XLogP | 2.87 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|