C15H20O5 — CID 134917871
(1S,3S,4R,8R,10S)-10,15,15-trimethyl-2,7,11-trioxatetracyclo[8.5.0.01,3.04,8]pentadecane-6,12-dione (PubChem CID 134917871) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1S,3S,4R,8R,10S)-10,15,15-trimethyl-2,7,11-trioxatetracyclo[8.5.0.01,3.04,8]pentadecane-6,12-dione.
| Compound Name | (1S,3S,4R,8R,10S)-10,15,15-trimethyl-2,7,11-trioxatetracyclo[8.5.0.01,3.04,8]pentadecane-6,12-dione |
|---|---|
| PubChem CID | 134917871 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1S,3S,4R,8R,10S)-10,15,15-trimethyl-2,7,11-trioxatetracyclo[8.5.0.01,3.04,8]pentadecane-6,12-dione |
| SMILES | CC1(C)CCC(=O)O[C@@]2(C)C[C@H]3OC(=O)C[C@H]3[C@@H]3O[C@]312 |
| InChI | InChI=1S/C15H20O5/c1-13(2)5-4-10(16)19-14(3)7-9-8(6-11(17)18-9)12-15(13,14)20-12/h8-9,12H,4-7H2,1-3H3/t8-,9-,12+,14+,15-/m1/s1 |
| InChIKey | HJOQFHWSSIOMCN-OJACKCGHSA-N |
| XLogP | 1.58 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|