C22H30O9 — CID 162987544
(6,8-diacetyloxy-3a,4-dimethyl-2-oxospiro[4,5,6,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-7,2'-oxirane]-6a-yl)methyl acetate (PubChem CID 162987544) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is (6,8-diacetyloxy-3a,4-dimethyl-2-oxospiro[4,5,6,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-7,2'-oxirane]-6a-yl)methyl acetate.
| Compound Name | (6,8-diacetyloxy-3a,4-dimethyl-2-oxospiro[4,5,6,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-7,2'-oxirane]-6a-yl)methyl acetate |
|---|---|
| PubChem CID | 162987544 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (6,8-diacetyloxy-3a,4-dimethyl-2-oxospiro[4,5,6,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-7,2'-oxirane]-6a-yl)methyl acetate |
| SMILES | CC(=O)OCC12C(OC(C)=O)CC(C)C3(C)CC(=O)OC31CCC(OC(C)=O)C21CO1 |
| InChI | InChI=1S/C22H30O9/c1-12-8-17(30-15(4)25)20(10-27-13(2)23)21(11-28-21)16(29-14(3)24)6-7-22(20)19(12,5)9-18(26)31-22/h12,16-17H,6-11H2,1-5H3 |
| InChIKey | IVTTWDZJSRRHQP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|