C12H23NO3 — CID 151304994
8-(dimethylamino)-5,5-dimethoxyoct-1-en-3-one (PubChem CID 151304994) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 8-(dimethylamino)-5,5-dimethoxyoct-1-en-3-one.
| Compound Name | 8-(dimethylamino)-5,5-dimethoxyoct-1-en-3-one |
|---|---|
| PubChem CID | 151304994 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 8-(dimethylamino)-5,5-dimethoxyoct-1-en-3-one |
| SMILES | C=CC(=O)CC(CCCN(C)C)(OC)OC |
| InChI | InChI=1S/C12H23NO3/c1-6-11(14)10-12(15-4,16-5)8-7-9-13(2)3/h6H,1,7-10H2,2-5H3 |
| InChIKey | ODFDADXNZHYFGH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|