C13H22N2O4 — CID 88599703
5,5-bis(2-aminoethoxy)nona-1,8-diene-3,7-dione (PubChem CID 88599703) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5,5-bis(2-aminoethoxy)nona-1,8-diene-3,7-dione.
| Compound Name | 5,5-bis(2-aminoethoxy)nona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 88599703 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5,5-bis(2-aminoethoxy)nona-1,8-diene-3,7-dione |
| SMILES | C=CC(=O)CC(CC(=O)C=C)(OCCN)OCCN |
| InChI | InChI=1S/C13H22N2O4/c1-3-11(16)9-13(18-7-5-14,19-8-6-15)10-12(17)4-2/h3-4H,1-2,5-10,14-15H2 |
| InChIKey | DXYKCGUJOIIUAG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|