C16H30O2 — CID 154937715
5,5-dimethyl-6-(2,4,4-trimethylpentan-2-yloxy)hex-1-en-3-one (PubChem CID 154937715) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 5,5-dimethyl-6-(2,4,4-trimethylpentan-2-yloxy)hex-1-en-3-one.
| Compound Name | 5,5-dimethyl-6-(2,4,4-trimethylpentan-2-yloxy)hex-1-en-3-one |
|---|---|
| PubChem CID | 154937715 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 5,5-dimethyl-6-(2,4,4-trimethylpentan-2-yloxy)hex-1-en-3-one |
| SMILES | C=CC(=O)CC(C)(C)COC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H30O2/c1-9-13(17)10-15(5,6)12-18-16(7,8)11-14(2,3)4/h9H,1,10-12H2,2-8H3 |
| InChIKey | SKDZBORMKAIQIU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|