C11H13ClO4S — CID 15130541
2-(4-chlorophenyl)sulfonyl-3-methylbutanoic acid (PubChem CID 15130541) has the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-methylbutanoic acid.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 15130541 |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO4S/c1-7(2)10(11(13)14)17(15,16)9-5-3-8(12)4-6-9/h3-7,10H,1-2H3,(H,13,14) |
| InChIKey | INENCMFZUFWPGV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |