C8H11FS — CID 15131266
(1S,4R,5S,6S)-5-fluoro-6-methylsulfanylbicyclo[2.2.1]hept-2-ene (PubChem CID 15131266) has the molecular formula C8H11FS and a molecular weight of 158.24 g/mol. Its IUPAC name is (1S,4R,5S,6S)-5-fluoro-6-methylsulfanylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5S,6S)-5-fluoro-6-methylsulfanylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 15131266 |
| Molecular Formula | C8H11FS |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (1S,4R,5S,6S)-5-fluoro-6-methylsulfanylbicyclo[2.2.1]hept-2-ene |
| SMILES | CS[C@@H]1[C@@H](F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C8H11FS/c1-10-8-6-3-2-5(4-6)7(8)9/h2-3,5-8H,4H2,1H3/t5-,6+,7-,8-/m0/s1 |
| InChIKey | KFXURMLCXIKZNU-YWIQKCBGSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|