C10H16S — CID 59107268
(5S,6S)-5,6-dimethyl-7-(tritiomethylsulfanyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 59107268) has the molecular formula C10H16S and a molecular weight of 170.31 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-7-(tritiomethylsulfanyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (5S,6S)-5,6-dimethyl-7-(tritiomethylsulfanyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 59107268 |
| Molecular Formula | C10H16S |
| Molecular Weight | 170.31 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-7-(tritiomethylsulfanyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | [3H]CSC1C2C=CC1[C@@H](C)[C@@H]2C |
| InChI | InChI=1S/C10H16S/c1-6-7(2)9-5-4-8(6)10(9)11-3/h4-10H,1-3H3/t6-,7-,8?,9?,10?/m0/s1/i3T |
| InChIKey | KHYQFMYSVVNKKO-CKOCMNGLSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|