C23H47NO3 — CID 151315506
1-amino-6-cyclohexyl-2-ethyl-2-nonan-3-ylhexane-1,1,5-triol (PubChem CID 151315506) has the molecular formula C23H47NO3 and a molecular weight of 385.63 g/mol. Its IUPAC name is 1-amino-6-cyclohexyl-2-ethyl-2-nonan-3-ylhexane-1,1,5-triol.
| Compound Name | 1-amino-6-cyclohexyl-2-ethyl-2-nonan-3-ylhexane-1,1,5-triol |
|---|---|
| PubChem CID | 151315506 |
| Molecular Formula | C23H47NO3 |
| Molecular Weight | 385.63 g/mol |
| Exact Mass | 385.36 |
| IUPAC Name | 1-amino-6-cyclohexyl-2-ethyl-2-nonan-3-ylhexane-1,1,5-triol |
| SMILES | CCCCCCC(CC)C(CC)(CCC(O)CC1CCCCC1)C(N)(O)O |
| InChI | InChI=1S/C23H47NO3/c1-4-7-8-12-15-20(5-2)22(6-3,23(24,26)27)17-16-21(25)18-19-13-10-9-11-14-19/h19-21,25-27H,4-18,24H2,1-3H3 |
| InChIKey | OFIIRYMAQZNDLJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|