C12H16N2O3 — CID 151319204
ethyl 2-(5-carbamoyl-2,6-dimethyl-3-pyridinyl)acetate (PubChem CID 151319204) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 2-(5-carbamoyl-2,6-dimethyl-3-pyridinyl)acetate.
| Compound Name | ethyl 2-(5-carbamoyl-2,6-dimethyl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 151319204 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl 2-(5-carbamoyl-2,6-dimethyl-3-pyridinyl)acetate |
| SMILES | CCOC(=O)Cc1cc(C(N)=O)c(C)nc1C |
| InChI | InChI=1S/C12H16N2O3/c1-4-17-11(15)6-9-5-10(12(13)16)8(3)14-7(9)2/h5H,4,6H2,1-3H3,(H2,13,16) |
| InChIKey | OGCFRBZBKIBGCU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |