C12H26O3S — CID 151328908
2,3-dimethylbutyl 2,2-dimethylbutane-1-sulfonate (PubChem CID 151328908) has the molecular formula C12H26O3S and a molecular weight of 250.40 g/mol. Its IUPAC name is 2,3-dimethylbutyl 2,2-dimethylbutane-1-sulfonate.
| Compound Name | 2,3-dimethylbutyl 2,2-dimethylbutane-1-sulfonate |
|---|---|
| PubChem CID | 151328908 |
| Molecular Formula | C12H26O3S |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2,3-dimethylbutyl 2,2-dimethylbutane-1-sulfonate |
| SMILES | CCC(C)(C)CS(=O)(=O)OCC(C)C(C)C |
| InChI | InChI=1S/C12H26O3S/c1-7-12(5,6)9-16(13,14)15-8-11(4)10(2)3/h10-11H,7-9H2,1-6H3 |
| InChIKey | OIATXCZNQSRLTH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|