C10H13ClN2O4 — CID 151336690
5-chloro-6-methyl-3-(oxan-2-yloxy)-1H-pyrimidine-2,4-dione (PubChem CID 151336690) has the molecular formula C10H13ClN2O4 and a molecular weight of 260.68 g/mol. Its IUPAC name is 5-chloro-6-methyl-3-(oxan-2-yloxy)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-chloro-6-methyl-3-(oxan-2-yloxy)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 151336690 |
| Molecular Formula | C10H13ClN2O4 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-chloro-6-methyl-3-(oxan-2-yloxy)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH]c(=O)n(OC2CCCCO2)c(=O)c1Cl |
| InChI | InChI=1S/C10H13ClN2O4/c1-6-8(11)9(14)13(10(15)12-6)17-7-4-2-3-5-16-7/h7H,2-5H2,1H3,(H,12,15) |
| InChIKey | OJOWPPGXEROLJF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |