C15H22N2O7 — CID 10783459
1,3-bis(oxan-2-yloxy)-1,3-diazepane-2,4,7-trione (PubChem CID 10783459) has the molecular formula C15H22N2O7 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1,3-bis(oxan-2-yloxy)-1,3-diazepane-2,4,7-trione.
| Compound Name | 1,3-bis(oxan-2-yloxy)-1,3-diazepane-2,4,7-trione |
|---|---|
| PubChem CID | 10783459 |
| Molecular Formula | C15H22N2O7 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1,3-bis(oxan-2-yloxy)-1,3-diazepane-2,4,7-trione |
| SMILES | O=C1CCC(=O)N(OC2CCCCO2)C(=O)N1OC1CCCCO1 |
| InChI | InChI=1S/C15H22N2O7/c18-11-7-8-12(19)17(24-14-6-2-4-10-22-14)15(20)16(11)23-13-5-1-3-9-21-13/h13-14H,1-10H2 |
| InChIKey | KSAQTQRZYXVTOU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |