C34H40N2O5 — CID 151344339
6,6-bis(4-methoxy-N-(4-methoxyphenyl)anilino)hexan-2-ol (PubChem CID 151344339) has the molecular formula C34H40N2O5 and a molecular weight of 556.70 g/mol. Its IUPAC name is 6,6-bis(4-methoxy-N-(4-methoxyphenyl)anilino)hexan-2-ol.
| Compound Name | 6,6-bis(4-methoxy-N-(4-methoxyphenyl)anilino)hexan-2-ol |
|---|---|
| PubChem CID | 151344339 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 6,6-bis(4-methoxy-N-(4-methoxyphenyl)anilino)hexan-2-ol |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)C(CCCC(C)O)N(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H40N2O5/c1-25(37)7-6-8-34(35(26-9-17-30(38-2)18-10-26)27-11-19-31(39-3)20-12-27)36(28-13-21-32(40-4)22-14-28)29-15-23-33(41-5)24-16-29/h9-25,34,37H,6-8H2,1-5H3 |
| InChIKey | OLDGMXJBOUIZAR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|