C18H28ClNO3Si — CID 151355470
CID 151355470 (PubChem CID 151355470) has the molecular formula C18H28ClNO3Si and a molecular weight of 369.97 g/mol.
| Compound Name | CID 151355470 |
|---|---|
| PubChem CID | 151355470 |
| Molecular Formula | C18H28ClNO3Si |
| Molecular Weight | 369.97 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | — |
| SMILES | CCN(CCc1ccc(Cl)c(C(C)(C)O[Si]C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C18H28ClNO3Si/c1-7-20(16(21)22)11-10-13-8-9-15(19)14(12-13)18(5,6)23-24-17(2,3)4/h8-9,12H,7,10-11H2,1-6H3,(H,21,22) |
| InChIKey | IKDDFCISHBUKMC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|