C18H26ClNO2Si — CID 67148606
CID 67148606 (PubChem CID 67148606) has the molecular formula C18H26ClNO2Si and a molecular weight of 351.95 g/mol.
| Compound Name | CID 67148606 |
|---|---|
| PubChem CID | 67148606 |
| Molecular Formula | C18H26ClNO2Si |
| Molecular Weight | 351.95 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1cc(CNC(=O)C2CC2)ccc1Cl |
| InChI | InChI=1S/C18H26ClNO2Si/c1-17(2,3)23-22-18(4,5)14-10-12(6-9-15(14)19)11-20-16(21)13-7-8-13/h6,9-10,13H,7-8,11H2,1-5H3,(H,20,21) |
| InChIKey | KCUICUUPMAAPKB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|