C23H25FN2O3 — CID 151356301
(3S)-3-[4-[(3-fluoro-1-propan-2-ylindazol-4-yl)methoxy]phenyl]hex-4-enoic acid (PubChem CID 151356301) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is (3S)-3-[4-[(3-fluoro-1-propan-2-ylindazol-4-yl)methoxy]phenyl]hex-4-enoic acid.
| Compound Name | (3S)-3-[4-[(3-fluoro-1-propan-2-ylindazol-4-yl)methoxy]phenyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 151356301 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (3S)-3-[4-[(3-fluoro-1-propan-2-ylindazol-4-yl)methoxy]phenyl]hex-4-enoic acid |
| SMILES | CC=C[C@H](CC(=O)O)c1ccc(OCc2cccc3c2c(F)nn3C(C)C)cc1 |
| InChI | InChI=1S/C23H25FN2O3/c1-4-6-17(13-21(27)28)16-9-11-19(12-10-16)29-14-18-7-5-8-20-22(18)23(24)25-26(20)15(2)3/h4-12,15,17H,13-14H2,1-3H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | ONNUGBMSFCOWDH-QGZVFWFLSA-N |
| XLogP | 5.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|