C26H31FN2O3 — CID 151491215
(3S)-3-[4-[[3-(fluoromethyl)-7-methyl-1-(2-methylpropyl)indazol-6-yl]methoxy]phenyl]hex-4-enoic acid (PubChem CID 151491215) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is (3S)-3-[4-[[3-(fluoromethyl)-7-methyl-1-(2-methylpropyl)indazol-6-yl]methoxy]phenyl]hex-4-enoic acid.
| Compound Name | (3S)-3-[4-[[3-(fluoromethyl)-7-methyl-1-(2-methylpropyl)indazol-6-yl]methoxy]phenyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 151491215 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (3S)-3-[4-[[3-(fluoromethyl)-7-methyl-1-(2-methylpropyl)indazol-6-yl]methoxy]phenyl]hex-4-enoic acid |
| SMILES | CC=C[C@H](CC(=O)O)c1ccc(OCc2ccc3c(CF)nn(CC(C)C)c3c2C)cc1 |
| InChI | InChI=1S/C26H31FN2O3/c1-5-6-20(13-25(30)31)19-7-10-22(11-8-19)32-16-21-9-12-23-24(14-27)28-29(15-17(2)3)26(23)18(21)4/h5-12,17,20H,13-16H2,1-4H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | POMUQQHKHSXLLF-HXUWFJFHSA-N |
| XLogP | 6.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|