C9H10O3 — CID 151359392
1-methoxycyclohexa-3,5-diene-1,3-dicarbaldehyde (PubChem CID 151359392) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-methoxycyclohexa-3,5-diene-1,3-dicarbaldehyde.
| Compound Name | 1-methoxycyclohexa-3,5-diene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 151359392 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 1-methoxycyclohexa-3,5-diene-1,3-dicarbaldehyde |
| SMILES | COC1(C=O)C=CC=C(C=O)C1 |
| InChI | InChI=1S/C9H10O3/c1-12-9(7-11)4-2-3-8(5-9)6-10/h2-4,6-7H,5H2,1H3 |
| InChIKey | OODQYWKHHBWACC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|